C15H30N6S — CID 111069882
1,1,3,3-tetramethyl-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine (PubChem CID 111069882) has the molecular formula C15H30N6S and a molecular weight of 326.51 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 111069882 |
| Molecular Formula | C15H30N6S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
| SMILES | CSc1nnc(CCCN=C(N(C)C)N(C)C)n1CC(C)C |
| InChI | InChI=1S/C15H30N6S/c1-12(2)11-21-13(17-18-15(21)22-7)9-8-10-16-14(19(3)4)20(5)6/h12H,8-11H2,1-7H3 |
| InChIKey | LPMLXXXMXQQBKI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|