C17H28N4 — CID 111070226
1-(3,5-dimethylphenyl)-2-(2-methyl-3-pyrrolidin-1-ylpropyl)guanidine (PubChem CID 111070226) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-(2-methyl-3-pyrrolidin-1-ylpropyl)guanidine.
| Compound Name | 1-(3,5-dimethylphenyl)-2-(2-methyl-3-pyrrolidin-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111070226 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-(2-methyl-3-pyrrolidin-1-ylpropyl)guanidine |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CC(C)CN2CCCC2)c1 |
| InChI | InChI=1S/C17H28N4/c1-13-8-14(2)10-16(9-13)20-17(18)19-11-15(3)12-21-6-4-5-7-21/h8-10,15H,4-7,11-12H2,1-3H3,(H3,18,19,20) |
| InChIKey | SLDHJLWKPXXUNU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|