C20H36IN5O2 — CID 111070331
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111070331) has the molecular formula C20H36IN5O2 and a molecular weight of 505.45 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111070331 |
| Molecular Formula | C20H36IN5O2 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/CC(C)CN2CCN(C)CC2)cc1OC.I |
| InChI | InChI=1S/C20H35N5O2.HI/c1-16(15-25-11-9-24(2)10-12-25)14-23-20(21)22-8-7-17-5-6-18(26-3)19(13-17)27-4;/h5-6,13,16H,7-12,14-15H2,1-4H3,(H3,21,22,23);1H |
| InChIKey | UVIITTZKJMWIAG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|