C18H36N6O2 — CID 111070356
ethyl 4-[[N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111070356) has the molecular formula C18H36N6O2 and a molecular weight of 368.53 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111070356 |
| Molecular Formula | C18H36N6O2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | ethyl 4-[[N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CC(C)CN2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C18H36N6O2/c1-4-26-18(25)24-7-5-16(6-8-24)21-17(19)20-13-15(2)14-23-11-9-22(3)10-12-23/h15-16H,4-14H2,1-3H3,(H3,19,20,21) |
| InChIKey | HQYVBHZRDAEALC-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 86.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|