About (3R)-3-hydroxy-1,3-diphenylpropan-1-one
(3R)-3-hydroxy-1,3-diphenylpropan-1-one (PubChem CID 11107049) has the molecular formula C15H14O2
and a molecular weight of 226.28 g/mol. Its IUPAC name is (3R)-3-hydroxy-1,3-diphenylpropan-1-one.
Molecular Properties
| Compound Name | (3R)-3-hydroxy-1,3-diphenylpropan-1-one |
| PubChem CID | 11107049 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (3R)-3-hydroxy-1,3-diphenylpropan-1-one |
| SMILES | O=C(C[C@@H](O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14O2/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-10,14,16H,11H2/t14-/m1/s1 |
| InChIKey | ZTCFOSQTSRNLHW-CQSZACIVSA-N |
| XLogP | 2.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-hydroxy-1,3-diphenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-hydroxy-1,3-diphenylpropan-1-one?
The IUPAC name of (3R)-3-hydroxy-1,3-diphenylpropan-1-one (CID 11107049) is (3R)-3-hydroxy-1,3-diphenylpropan-1-one.
What is the SMILES notation for (3R)-3-hydroxy-1,3-diphenylpropan-1-one?
The canonical SMILES for (3R)-3-hydroxy-1,3-diphenylpropan-1-one is O=C(C[C@@H](O)c1ccccc1)c1ccccc1.
What is the InChIKey of (3R)-3-hydroxy-1,3-diphenylpropan-1-one?
The InChIKey is ZTCFOSQTSRNLHW-CQSZACIVSA-N. The full InChI is InChI=1S/C15H14O2/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-10,14,16H,11H2/t14-/m1/s1.
What are the key properties of (3R)-3-hydroxy-1,3-diphenylpropan-1-one?
(3R)-3-hydroxy-1,3-diphenylpropan-1-one has a molecular weight of 226.28 g/mol, XLogP of 2.99, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-hydroxy-1,3-diphenylpropan-1-one is sourced from PubChem (CID 11107049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).