C12H23N5 — CID 111070558
1,1,3,3-tetramethyl-2-(2-methyl-3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111070558) has the molecular formula C12H23N5 and a molecular weight of 237.35 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-(2-methyl-3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-(2-methyl-3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111070558 |
| Molecular Formula | C12H23N5 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-(2-methyl-3-pyrazol-1-ylpropyl)guanidine |
| SMILES | CC(CN=C(N(C)C)N(C)C)Cn1cccn1 |
| InChI | InChI=1S/C12H23N5/c1-11(10-17-8-6-7-14-17)9-13-12(15(2)3)16(4)5/h6-8,11H,9-10H2,1-5H3 |
| InChIKey | BMHLELQQLDQHLI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|