About [(2E)-3,7-dimethylocta-2,6-dienyl] ethyl carbonate
[(2E)-3,7-dimethylocta-2,6-dienyl] ethyl carbonate (PubChem CID 11107057) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] ethyl carbonate.
Molecular Properties
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] ethyl carbonate |
| PubChem CID | 11107057 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] ethyl carbonate |
| SMILES | CCOC(=O)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C13H22O3/c1-5-15-13(14)16-10-9-12(4)8-6-7-11(2)3/h7,9H,5-6,8,10H2,1-4H3/b12-9+ |
| InChIKey | VHCQYGMNMOULRZ-FMIVXFBMSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-3,7-dimethylocta-2,6-dienyl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-3,7-dimethylocta-2,6-dienyl] ethyl carbonate?
The IUPAC name of [(2E)-3,7-dimethylocta-2,6-dienyl] ethyl carbonate (CID 11107057) is [(2E)-3,7-dimethylocta-2,6-dienyl] ethyl carbonate.
What is the SMILES notation for [(2E)-3,7-dimethylocta-2,6-dienyl] ethyl carbonate?
The canonical SMILES for [(2E)-3,7-dimethylocta-2,6-dienyl] ethyl carbonate is CCOC(=O)OC/C=C(\C)CCC=C(C)C.
What is the InChIKey of [(2E)-3,7-dimethylocta-2,6-dienyl] ethyl carbonate?
The InChIKey is VHCQYGMNMOULRZ-FMIVXFBMSA-N. The full InChI is InChI=1S/C13H22O3/c1-5-15-13(14)16-10-9-12(4)8-6-7-11(2)3/h7,9H,5-6,8,10H2,1-4H3/b12-9+.
What are the key properties of [(2E)-3,7-dimethylocta-2,6-dienyl] ethyl carbonate?
[(2E)-3,7-dimethylocta-2,6-dienyl] ethyl carbonate has a molecular weight of 226.32 g/mol, XLogP of 3.85, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-3,7-dimethylocta-2,6-dienyl] ethyl carbonate is sourced from PubChem (CID 11107057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).