About tert-butyl 4-[2-[bis(dimethylamino)methylideneamino]ethyl]piperazine-1-carboxylate;hydroiodide
tert-butyl 4-[2-[bis(dimethylamino)methylideneamino]ethyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111070957) has the molecular formula C16H34IN5O2
and a molecular weight of 455.39 g/mol. Its IUPAC name is tert-butyl 4-[2-[bis(dimethylamino)methylideneamino]ethyl]piperazine-1-carboxylate;hydroiodide.
Molecular Properties
| Compound Name | tert-butyl 4-[2-[bis(dimethylamino)methylideneamino]ethyl]piperazine-1-carboxylate;hydroiodide |
| PubChem CID | 111070957 |
| Molecular Formula | C16H34IN5O2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | tert-butyl 4-[2-[bis(dimethylamino)methylideneamino]ethyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CN(C)C(=NCCN1CCN(C(=O)OC(C)(C)C)CC1)N(C)C.I |
| InChI | InChI=1S/C16H33N5O2.HI/c1-16(2,3)23-15(22)21-12-10-20(11-13-21)9-8-17-14(18(4)5)19(6)7;/h8-13H2,1-7H3;1H |
| InChIKey | DOUHSPNSRWUKKX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 51.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[2-[bis(dimethylamino)methylideneamino]ethyl]piperazine-1-carboxylate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[2-[bis(dimethylamino)methylideneamino]ethyl]piperazine-1-carboxylate;hydroiodide?
The IUPAC name of tert-butyl 4-[2-[bis(dimethylamino)methylideneamino]ethyl]piperazine-1-carboxylate;hydroiodide (CID 111070957) is tert-butyl 4-[2-[bis(dimethylamino)methylideneamino]ethyl]piperazine-1-carboxylate;hydroiodide.
What is the SMILES notation for tert-butyl 4-[2-[bis(dimethylamino)methylideneamino]ethyl]piperazine-1-carboxylate;hydroiodide?
The canonical SMILES for tert-butyl 4-[2-[bis(dimethylamino)methylideneamino]ethyl]piperazine-1-carboxylate;hydroiodide is CN(C)C(=NCCN1CCN(C(=O)OC(C)(C)C)CC1)N(C)C.I.
What is the InChIKey of tert-butyl 4-[2-[bis(dimethylamino)methylideneamino]ethyl]piperazine-1-carboxylate;hydroiodide?
The InChIKey is DOUHSPNSRWUKKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33N5O2.HI/c1-16(2,3)23-15(22)21-12-10-20(11-13-21)9-8-17-14(18(4)5)19(6)7;/h8-13H2,1-7H3;1H.
What are the key properties of tert-butyl 4-[2-[bis(dimethylamino)methylideneamino]ethyl]piperazine-1-carboxylate;hydroiodide?
tert-butyl 4-[2-[bis(dimethylamino)methylideneamino]ethyl]piperazine-1-carboxylate;hydroiodide has a molecular weight of 455.39 g/mol, XLogP of 1.64, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[2-[bis(dimethylamino)methylideneamino]ethyl]piperazine-1-carboxylate;hydroiodide is sourced from PubChem (CID 111070957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).