C11H18O5 — CID 11107147
(1S,5R,6R,8R)-3-butyl-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol (PubChem CID 11107147) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is (1S,5R,6R,8R)-3-butyl-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol.
| Compound Name | (1S,5R,6R,8R)-3-butyl-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol |
|---|---|
| PubChem CID | 11107147 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (1S,5R,6R,8R)-3-butyl-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol |
| SMILES | CCCCC12OC3[C@H](O)[C@H](C[C@@H](O1)[C@H]3O)O2 |
| InChI | InChI=1S/C11H18O5/c1-2-3-4-11-14-6-5-7(15-11)9(13)10(16-11)8(6)12/h6-10,12-13H,2-5H2,1H3/t6-,7+,8-,9-,10?,11?/m1/s1 |
| InChIKey | YDBBCZSNTDXIMQ-KGVHGQBYSA-N |
| XLogP | 0.14 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |