About 2-ethylthiochromeno[3,2-b]furan-9-one
2-ethylthiochromeno[3,2-b]furan-9-one (PubChem CID 11107153) has the molecular formula C13H10O2S
and a molecular weight of 230.29 g/mol. Its IUPAC name is 2-ethylthiochromeno[3,2-b]furan-9-one.
Molecular Properties
| Compound Name | 2-ethylthiochromeno[3,2-b]furan-9-one |
| PubChem CID | 11107153 |
| Molecular Formula | C13H10O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-ethylthiochromeno[3,2-b]furan-9-one |
| SMILES | CCc1cc2sc3ccccc3c(=O)c2o1 |
| InChI | InChI=1S/C13H10O2S/c1-2-8-7-11-13(15-8)12(14)9-5-3-4-6-10(9)16-11/h3-7H,2H2,1H3 |
| InChIKey | ZKRDHTDXLHLZRA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylthiochromeno[3,2-b]furan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylthiochromeno[3,2-b]furan-9-one?
The IUPAC name of 2-ethylthiochromeno[3,2-b]furan-9-one (CID 11107153) is 2-ethylthiochromeno[3,2-b]furan-9-one.
What is the SMILES notation for 2-ethylthiochromeno[3,2-b]furan-9-one?
The canonical SMILES for 2-ethylthiochromeno[3,2-b]furan-9-one is CCc1cc2sc3ccccc3c(=O)c2o1.
What is the InChIKey of 2-ethylthiochromeno[3,2-b]furan-9-one?
The InChIKey is ZKRDHTDXLHLZRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2S/c1-2-8-7-11-13(15-8)12(14)9-5-3-4-6-10(9)16-11/h3-7H,2H2,1H3.
What are the key properties of 2-ethylthiochromeno[3,2-b]furan-9-one?
2-ethylthiochromeno[3,2-b]furan-9-one has a molecular weight of 230.29 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylthiochromeno[3,2-b]furan-9-one is sourced from PubChem (CID 11107153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).