C7H11F3O5 — CID 11107194
(2R,3R,4R,5R)-2-methoxy-3-(trifluoromethyl)oxane-3,4,5-triol (PubChem CID 11107194) has the molecular formula C7H11F3O5 and a molecular weight of 232.15 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-methoxy-3-(trifluoromethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R)-2-methoxy-3-(trifluoromethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11107194 |
| Molecular Formula | C7H11F3O5 |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | (2R,3R,4R,5R)-2-methoxy-3-(trifluoromethyl)oxane-3,4,5-triol |
| SMILES | CO[C@@H]1OC[C@@H](O)[C@@H](O)[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C7H11F3O5/c1-14-5-6(13,7(8,9)10)4(12)3(11)2-15-5/h3-5,11-13H,2H2,1H3/t3-,4-,5-,6-/m1/s1 |
| InChIKey | STFFISKKLNTXPG-KVTDHHQDSA-N |
| XLogP | -1.00 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |