C10H23IN4O — CID 111072590
3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111072590) has the molecular formula C10H23IN4O and a molecular weight of 342.23 g/mol. Its IUPAC name is 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111072590 |
| Molecular Formula | C10H23IN4O |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CN(C)C(=NCC(C)(C)C(N)=O)N(C)C.I |
| InChI | InChI=1S/C10H22N4O.HI/c1-10(2,8(11)15)7-12-9(13(3)4)14(5)6;/h7H2,1-6H3,(H2,11,15);1H |
| InChIKey | SRULSBZLDFTDEC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|