About 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide
3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111072590) has the molecular formula C10H23IN4O
and a molecular weight of 342.23 g/mol. Its IUPAC name is 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide.
Molecular Properties
| Compound Name | 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide |
| PubChem CID | 111072590 |
| Molecular Formula | C10H23IN4O |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CN(C)C(=NCC(C)(C)C(N)=O)N(C)C.I |
| InChI | InChI=1S/C10H22N4O.HI/c1-10(2,8(11)15)7-12-9(13(3)4)14(5)6;/h7H2,1-6H3,(H2,11,15);1H |
| InChIKey | SRULSBZLDFTDEC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide?
The IUPAC name of 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide (CID 111072590) is 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide.
What is the SMILES notation for 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide?
The canonical SMILES for 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide is CN(C)C(=NCC(C)(C)C(N)=O)N(C)C.I.
What is the InChIKey of 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide?
The InChIKey is SRULSBZLDFTDEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N4O.HI/c1-10(2,8(11)15)7-12-9(13(3)4)14(5)6;/h7H2,1-6H3,(H2,11,15);1H.
What are the key properties of 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide?
3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide has a molecular weight of 342.23 g/mol, XLogP of 0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bis(dimethylamino)methylideneamino]-2,2-dimethylpropanamide;hydroiodide is sourced from PubChem (CID 111072590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).