C15H24O2 — CID 11107360
(1R,2R,10S)-2,6,6,10-tetramethyl-9,13-dioxatricyclo[8.2.1.02,7]tridec-7-ene (PubChem CID 11107360) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1R,2R,10S)-2,6,6,10-tetramethyl-9,13-dioxatricyclo[8.2.1.02,7]tridec-7-ene.
| Compound Name | (1R,2R,10S)-2,6,6,10-tetramethyl-9,13-dioxatricyclo[8.2.1.02,7]tridec-7-ene |
|---|---|
| PubChem CID | 11107360 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1R,2R,10S)-2,6,6,10-tetramethyl-9,13-dioxatricyclo[8.2.1.02,7]tridec-7-ene |
| SMILES | CC1(C)CCC[C@]2(C)C1=CO[C@]1(C)CC[C@H]2O1 |
| InChI | InChI=1S/C15H24O2/c1-13(2)7-5-8-14(3)11(13)10-16-15(4)9-6-12(14)17-15/h10,12H,5-9H2,1-4H3/t12-,14-,15+/m1/s1 |
| InChIKey | HDLBYWIWUOTUBE-YUELXQCFSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |