C16H18N4O — CID 111073641
2-[[amino-(4-methylanilino)methylidene]amino]-N-phenylacetamide (PubChem CID 111073641) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-[[amino-(4-methylanilino)methylidene]amino]-N-phenylacetamide.
| Compound Name | 2-[[amino-(4-methylanilino)methylidene]amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 111073641 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-[[amino-(4-methylanilino)methylidene]amino]-N-phenylacetamide |
| SMILES | Cc1ccc(N/C(N)=N/CC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C16H18N4O/c1-12-7-9-14(10-8-12)20-16(17)18-11-15(21)19-13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,19,21)(H3,17,18,20) |
| InChIKey | ZLPAQXBMCWZKPN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|