C12H14O5 — CID 11107394
2,4-diacetyl-3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one (PubChem CID 11107394) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is 2,4-diacetyl-3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one.
| Compound Name | 2,4-diacetyl-3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 11107394 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2,4-diacetyl-3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one |
| SMILES | CC(=O)C1=C(O)C(C(C)=O)=C(O)C(C)(C)C1=O |
| InChI | InChI=1S/C12H14O5/c1-5(13)7-9(15)8(6(2)14)11(17)12(3,4)10(7)16/h15-16H,1-4H3 |
| InChIKey | JUKLIGUGYTTWOJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|