C19H25IN4O3 — CID 111074576
2-[3-[[[amino-(2-methoxyanilino)methylidene]amino]methyl]phenoxy]-N-ethylacetamide;hydroiodide (PubChem CID 111074576) has the molecular formula C19H25IN4O3 and a molecular weight of 484.34 g/mol. Its IUPAC name is 2-[3-[[[amino-(2-methoxyanilino)methylidene]amino]methyl]phenoxy]-N-ethylacetamide;hydroiodide.
| Compound Name | 2-[3-[[[amino-(2-methoxyanilino)methylidene]amino]methyl]phenoxy]-N-ethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111074576 |
| Molecular Formula | C19H25IN4O3 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 2-[3-[[[amino-(2-methoxyanilino)methylidene]amino]methyl]phenoxy]-N-ethylacetamide;hydroiodide |
| SMILES | CCNC(=O)COc1cccc(C/N=C(\N)Nc2ccccc2OC)c1.I |
| InChI | InChI=1S/C19H24N4O3.HI/c1-3-21-18(24)13-26-15-8-6-7-14(11-15)12-22-19(20)23-16-9-4-5-10-17(16)25-2;/h4-11H,3,12-13H2,1-2H3,(H,21,24)(H3,20,22,23);1H |
| InChIKey | ASZMHOVISHBTEJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|