About 5-(1,3-dithian-2-yl)-1,3-benzodioxole
5-(1,3-dithian-2-yl)-1,3-benzodioxole (PubChem CID 11107478) has the molecular formula C11H12O2S2
and a molecular weight of 240.35 g/mol. Its IUPAC name is 5-(1,3-dithian-2-yl)-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-(1,3-dithian-2-yl)-1,3-benzodioxole |
| PubChem CID | 11107478 |
| Molecular Formula | C11H12O2S2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 5-(1,3-dithian-2-yl)-1,3-benzodioxole |
| SMILES | c1cc2c(cc1C1SCCCS1)OCO2 |
| InChI | InChI=1S/C11H12O2S2/c1-4-14-11(15-5-1)8-2-3-9-10(6-8)13-7-12-9/h2-3,6,11H,1,4-5,7H2 |
| InChIKey | DMJZKGGHTJZDBW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,3-dithian-2-yl)-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dithian-2-yl)-1,3-benzodioxole?
The IUPAC name of 5-(1,3-dithian-2-yl)-1,3-benzodioxole (CID 11107478) is 5-(1,3-dithian-2-yl)-1,3-benzodioxole.
What is the SMILES notation for 5-(1,3-dithian-2-yl)-1,3-benzodioxole?
The canonical SMILES for 5-(1,3-dithian-2-yl)-1,3-benzodioxole is c1cc2c(cc1C1SCCCS1)OCO2.
What is the InChIKey of 5-(1,3-dithian-2-yl)-1,3-benzodioxole?
The InChIKey is DMJZKGGHTJZDBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2S2/c1-4-14-11(15-5-1)8-2-3-9-10(6-8)13-7-12-9/h2-3,6,11H,1,4-5,7H2.
What are the key properties of 5-(1,3-dithian-2-yl)-1,3-benzodioxole?
5-(1,3-dithian-2-yl)-1,3-benzodioxole has a molecular weight of 240.35 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dithian-2-yl)-1,3-benzodioxole is sourced from PubChem (CID 11107478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).