C11H19FO3Si — CID 11107643
methyl (1S,2S)-3-fluoro-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate (PubChem CID 11107643) has the molecular formula C11H19FO3Si and a molecular weight of 246.35 g/mol. Its IUPAC name is methyl (1S,2S)-3-fluoro-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,2S)-3-fluoro-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11107643 |
| Molecular Formula | C11H19FO3Si |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | methyl (1S,2S)-3-fluoro-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CCC=C(F)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C11H19FO3Si/c1-14-11(13)8-6-5-7-9(12)10(8)15-16(2,3)4/h7-8,10H,5-6H2,1-4H3/t8-,10-/m0/s1 |
| InChIKey | WBOYEZKZJIINQK-WPRPVWTQSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|