C17H19F3IN3O2 — CID 111076988
1-(3-methoxyphenyl)-2-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111076988) has the molecular formula C17H19F3IN3O2 and a molecular weight of 481.26 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-methoxyphenyl)-2-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111076988 |
| Molecular Formula | C17H19F3IN3O2 |
| Molecular Weight | 481.26 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | COc1cccc(N/C(N)=N/Cc2ccccc2OCC(F)(F)F)c1.I |
| InChI | InChI=1S/C17H18F3N3O2.HI/c1-24-14-7-4-6-13(9-14)23-16(21)22-10-12-5-2-3-8-15(12)25-11-17(18,19)20;/h2-9H,10-11H2,1H3,(H3,21,22,23);1H |
| InChIKey | FOZAOWKUXJFVTK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.26 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|