C15H20O3 — CID 11107700
(3S,3aS,5aR,8S,8aS,8bS)-5a-ethenyl-3,8-dimethyl-3,3a,4,5,6,8,8a,8b-octahydrocyclopenta[g][1]benzofuran-2,7-dione (PubChem CID 11107700) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (3S,3aS,5aR,8S,8aS,8bS)-5a-ethenyl-3,8-dimethyl-3,3a,4,5,6,8,8a,8b-octahydrocyclopenta[g][1]benzofuran-2,7-dione.
| Compound Name | (3S,3aS,5aR,8S,8aS,8bS)-5a-ethenyl-3,8-dimethyl-3,3a,4,5,6,8,8a,8b-octahydrocyclopenta[g][1]benzofuran-2,7-dione |
|---|---|
| PubChem CID | 11107700 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3S,3aS,5aR,8S,8aS,8bS)-5a-ethenyl-3,8-dimethyl-3,3a,4,5,6,8,8a,8b-octahydrocyclopenta[g][1]benzofuran-2,7-dione |
| SMILES | C=C[C@]12CC[C@@H]3[C@H](OC(=O)[C@H]3C)[C@H]1[C@H](C)C(=O)C2 |
| InChI | InChI=1S/C15H20O3/c1-4-15-6-5-10-8(2)14(17)18-13(10)12(15)9(3)11(16)7-15/h4,8-10,12-13H,1,5-7H2,2-3H3/t8-,9+,10-,12+,13-,15+/m0/s1 |
| InChIKey | CTMAWOXXLVUIJP-ALKKWDPBSA-N |
| XLogP | 2.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|