About (6R)-2-hydroxy-6-[2-[(2R,6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]ethyl]-2H-pyran-5-one
(6R)-2-hydroxy-6-[2-[(2R,6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]ethyl]-2H-pyran-5-one (PubChem CID 11107872) has the molecular formula C12H14O6
and a molecular weight of 254.24 g/mol. Its IUPAC name is (6R)-2-hydroxy-6-[2-[(2R,6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]ethyl]-2H-pyran-5-one.
Molecular Properties
| Compound Name | (6R)-2-hydroxy-6-[2-[(2R,6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]ethyl]-2H-pyran-5-one |
| PubChem CID | 11107872 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (6R)-2-hydroxy-6-[2-[(2R,6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]ethyl]-2H-pyran-5-one |
| SMILES | O=C1C=C[C@H](O)O[C@H]1CC[C@H]1OC(O)C=CC1=O |
| InChI | InChI=1S/C12H14O6/c13-7-1-5-11(15)17-9(7)3-4-10-8(14)2-6-12(16)18-10/h1-2,5-6,9-12,15-16H,3-4H2/t9-,10+,11+,12?/m0/s1 |
| InChIKey | STZOUSPTFJOCKQ-YZTHKRDXSA-N |
| XLogP | -0.55 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6R)-2-hydroxy-6-[2-[(2R,6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]ethyl]-2H-pyran-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-2-hydroxy-6-[2-[(2R,6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]ethyl]-2H-pyran-5-one?
The IUPAC name of (6R)-2-hydroxy-6-[2-[(2R,6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]ethyl]-2H-pyran-5-one (CID 11107872) is (6R)-2-hydroxy-6-[2-[(2R,6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]ethyl]-2H-pyran-5-one.
What is the SMILES notation for (6R)-2-hydroxy-6-[2-[(2R,6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]ethyl]-2H-pyran-5-one?
The canonical SMILES for (6R)-2-hydroxy-6-[2-[(2R,6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]ethyl]-2H-pyran-5-one is O=C1C=C[C@H](O)O[C@H]1CC[C@H]1OC(O)C=CC1=O.
What is the InChIKey of (6R)-2-hydroxy-6-[2-[(2R,6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]ethyl]-2H-pyran-5-one?
The InChIKey is STZOUSPTFJOCKQ-YZTHKRDXSA-N. The full InChI is InChI=1S/C12H14O6/c13-7-1-5-11(15)17-9(7)3-4-10-8(14)2-6-12(16)18-10/h1-2,5-6,9-12,15-16H,3-4H2/t9-,10+,11+,12?/m0/s1.
What are the key properties of (6R)-2-hydroxy-6-[2-[(2R,6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]ethyl]-2H-pyran-5-one?
(6R)-2-hydroxy-6-[2-[(2R,6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]ethyl]-2H-pyran-5-one has a molecular weight of 254.24 g/mol, XLogP of -0.55, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-2-hydroxy-6-[2-[(2R,6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]ethyl]-2H-pyran-5-one is sourced from PubChem (CID 11107872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).