carbon monoxide;chromium;1,3,5-trimethylbenzene

C12H12CrO3 — CID 11107945

IUPACcarbon monoxide;chromium;1,3,5-trimethylbenzene
SMILESCc1cc(C)cc(C)c1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr]
InChIInChI=1S/C9H12.3CO.Cr/c1-7-4-8(2)6-9(3)5-7;3*1-2;/h4-6H,1-3H3;;;;
InChIKeyNIONDGZOEVKXEP-UHFFFAOYSA-N
MW256.22 g/mol
LogP2.50
Rot. Bonds

About carbon monoxide;chromium;1,3,5-trimethylbenzene

carbon monoxide;chromium;1,3,5-trimethylbenzene (PubChem CID 11107945) has the molecular formula C12H12CrO3 and a molecular weight of 256.22 g/mol. Its IUPAC name is carbon monoxide;chromium;1,3,5-trimethylbenzene.

Molecular Properties

Compound Namecarbon monoxide;chromium;1,3,5-trimethylbenzene
PubChem CID11107945
Molecular FormulaC12H12CrO3
Molecular Weight256.22 g/mol
Exact Mass256.02
IUPAC Namecarbon monoxide;chromium;1,3,5-trimethylbenzene
SMILESCc1cc(C)cc(C)c1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr]
InChIInChI=1S/C9H12.3CO.Cr/c1-7-4-8(2)6-9(3)5-7;3*1-2;/h4-6H,1-3H3;;;;
InChIKeyNIONDGZOEVKXEP-UHFFFAOYSA-N
XLogP2.50
TPSA59.70 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.22
LogP ≤ 52.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}

Analyze carbon monoxide;chromium;1,3,5-trimethylbenzene with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon monoxide;chromium;1,3,5-trimethylbenzene?
The IUPAC name of carbon monoxide;chromium;1,3,5-trimethylbenzene (CID 11107945) is carbon monoxide;chromium;1,3,5-trimethylbenzene.
What is the SMILES notation for carbon monoxide;chromium;1,3,5-trimethylbenzene?
The canonical SMILES for carbon monoxide;chromium;1,3,5-trimethylbenzene is Cc1cc(C)cc(C)c1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].
What is the InChIKey of carbon monoxide;chromium;1,3,5-trimethylbenzene?
The InChIKey is NIONDGZOEVKXEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.3CO.Cr/c1-7-4-8(2)6-9(3)5-7;3*1-2;/h4-6H,1-3H3;;;;.
What are the key properties of carbon monoxide;chromium;1,3,5-trimethylbenzene?
carbon monoxide;chromium;1,3,5-trimethylbenzene has a molecular weight of 256.22 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;chromium;1,3,5-trimethylbenzene is sourced from PubChem (CID 11107945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).