C16H35IN4 — CID 111080124
2-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 111080124) has the molecular formula C16H35IN4 and a molecular weight of 410.39 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111080124 |
| Molecular Formula | C16H35IN4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 2-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | CC1CC(C)CN(C(C)(C)CN=C(N(C)C)N(C)C)C1.I |
| InChI | InChI=1S/C16H34N4.HI/c1-13-9-14(2)11-20(10-13)16(3,4)12-17-15(18(5)6)19(7)8;/h13-14H,9-12H2,1-8H3;1H |
| InChIKey | BPVIACMPGROMQZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|