C11H20ClNO2Si — CID 11108122
(6S,8R,8aS)-6-chloro-8-trimethylsilyloxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 11108122) has the molecular formula C11H20ClNO2Si and a molecular weight of 261.82 g/mol. Its IUPAC name is (6S,8R,8aS)-6-chloro-8-trimethylsilyloxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (6S,8R,8aS)-6-chloro-8-trimethylsilyloxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 11108122 |
| Molecular Formula | C11H20ClNO2Si |
| Molecular Weight | 261.82 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (6S,8R,8aS)-6-chloro-8-trimethylsilyloxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | C[Si](C)(C)O[C@@H]1C[C@H](Cl)C(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C11H20ClNO2Si/c1-16(2,3)15-10-7-8(12)11(14)13-6-4-5-9(10)13/h8-10H,4-7H2,1-3H3/t8-,9-,10+/m0/s1 |
| InChIKey | FCTSWXDIIACCOO-LPEHRKFASA-N |
| XLogP | 2.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.82 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|