C16H24O3 — CID 11108225
(1R,2S,6R,7R,10R,12S,13S)-9-hydroxy-3,3,6-trimethyl-8-oxatetracyclo[5.5.1.02,6.010,13]tridecane-12-carbaldehyde (PubChem CID 11108225) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (1R,2S,6R,7R,10R,12S,13S)-9-hydroxy-3,3,6-trimethyl-8-oxatetracyclo[5.5.1.02,6.010,13]tridecane-12-carbaldehyde.
| Compound Name | (1R,2S,6R,7R,10R,12S,13S)-9-hydroxy-3,3,6-trimethyl-8-oxatetracyclo[5.5.1.02,6.010,13]tridecane-12-carbaldehyde |
|---|---|
| PubChem CID | 11108225 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (1R,2S,6R,7R,10R,12S,13S)-9-hydroxy-3,3,6-trimethyl-8-oxatetracyclo[5.5.1.02,6.010,13]tridecane-12-carbaldehyde |
| SMILES | CC1(C)CC[C@@]2(C)[C@@H]3OC(O)[C@@H]4C[C@H](C=O)[C@@H]([C@H]34)[C@@H]12 |
| InChI | InChI=1S/C16H24O3/c1-15(2)4-5-16(3)12(15)10-8(7-17)6-9-11(10)13(16)19-14(9)18/h7-14,18H,4-6H2,1-3H3/t8-,9-,10+,11-,12+,13-,14?,16-/m1/s1 |
| InChIKey | RFEHYABCMGBNTP-TVIRYCDTSA-N |
| XLogP | 2.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|