About 2-[4-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]butoxy]oxane
2-[4-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]butoxy]oxane (PubChem CID 11108235) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-[4-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]butoxy]oxane.
Molecular Properties
| Compound Name | 2-[4-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]butoxy]oxane |
| PubChem CID | 11108235 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 2-[4-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]butoxy]oxane |
| SMILES | C1=C\CC(CCCCOC2CCCCO2)/C=C\CC/1 |
| InChI | InChI=1S/C17H28O2/c1-2-4-10-16(11-5-3-1)12-6-8-14-18-17-13-7-9-15-19-17/h2,4-5,11,16-17H,1,3,6-10,12-15H2/b4-2-,11-5- |
| InChIKey | LDSZDJJDURJGKY-NLYFXTHYSA-N |
| XLogP | 4.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]butoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]butoxy]oxane?
The IUPAC name of 2-[4-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]butoxy]oxane (CID 11108235) is 2-[4-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]butoxy]oxane.
What is the SMILES notation for 2-[4-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]butoxy]oxane?
The canonical SMILES for 2-[4-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]butoxy]oxane is C1=C\CC(CCCCOC2CCCCO2)/C=C\CC/1.
What is the InChIKey of 2-[4-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]butoxy]oxane?
The InChIKey is LDSZDJJDURJGKY-NLYFXTHYSA-N. The full InChI is InChI=1S/C17H28O2/c1-2-4-10-16(11-5-3-1)12-6-8-14-18-17-13-7-9-15-19-17/h2,4-5,11,16-17H,1,3,6-10,12-15H2/b4-2-,11-5-.
What are the key properties of 2-[4-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]butoxy]oxane?
2-[4-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]butoxy]oxane has a molecular weight of 264.41 g/mol, XLogP of 4.61, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]butoxy]oxane is sourced from PubChem (CID 11108235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).