C14H18O5 — CID 11108278
(1R,2R,3R,9S,10R,14R)-3,12,12-trimethyl-8,11,13,15-tetraoxatetracyclo[7.6.0.02,6.010,14]pentadec-5-en-4-one (PubChem CID 11108278) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (1R,2R,3R,9S,10R,14R)-3,12,12-trimethyl-8,11,13,15-tetraoxatetracyclo[7.6.0.02,6.010,14]pentadec-5-en-4-one.
| Compound Name | (1R,2R,3R,9S,10R,14R)-3,12,12-trimethyl-8,11,13,15-tetraoxatetracyclo[7.6.0.02,6.010,14]pentadec-5-en-4-one |
|---|---|
| PubChem CID | 11108278 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (1R,2R,3R,9S,10R,14R)-3,12,12-trimethyl-8,11,13,15-tetraoxatetracyclo[7.6.0.02,6.010,14]pentadec-5-en-4-one |
| SMILES | C[C@H]1C(=O)C=C2CO[C@@H]3[C@H]4OC(C)(C)O[C@H]4O[C@@H]3[C@@H]21 |
| InChI | InChI=1S/C14H18O5/c1-6-8(15)4-7-5-16-11-10(9(6)7)17-13-12(11)18-14(2,3)19-13/h4,6,9-13H,5H2,1-3H3/t6-,9+,10+,11-,12+,13+/m0/s1 |
| InChIKey | OPDCXBJEXVCEMF-ZIZZOTJTSA-N |
| XLogP | 1.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |