About 3-ethenyl-2,2,4-trimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde
3-ethenyl-2,2,4-trimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde (PubChem CID 11108313) has the molecular formula C15H26O2Si
and a molecular weight of 266.46 g/mol. Its IUPAC name is 3-ethenyl-2,2,4-trimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde.
Molecular Properties
| Compound Name | 3-ethenyl-2,2,4-trimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde |
| PubChem CID | 11108313 |
| Molecular Formula | C15H26O2Si |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 3-ethenyl-2,2,4-trimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde |
| SMILES | C=CC1=C(C)CCC(C=O)(O[Si](C)(C)C)C1(C)C |
| InChI | InChI=1S/C15H26O2Si/c1-8-13-12(2)9-10-15(11-16,14(13,3)4)17-18(5,6)7/h8,11H,1,9-10H2,2-7H3 |
| InChIKey | LIXULGSPLRZSQZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-2,2,4-trimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-2,2,4-trimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde?
The IUPAC name of 3-ethenyl-2,2,4-trimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde (CID 11108313) is 3-ethenyl-2,2,4-trimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde.
What is the SMILES notation for 3-ethenyl-2,2,4-trimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde?
The canonical SMILES for 3-ethenyl-2,2,4-trimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde is C=CC1=C(C)CCC(C=O)(O[Si](C)(C)C)C1(C)C.
What is the InChIKey of 3-ethenyl-2,2,4-trimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde?
The InChIKey is LIXULGSPLRZSQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O2Si/c1-8-13-12(2)9-10-15(11-16,14(13,3)4)17-18(5,6)7/h8,11H,1,9-10H2,2-7H3.
What are the key properties of 3-ethenyl-2,2,4-trimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde?
3-ethenyl-2,2,4-trimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde has a molecular weight of 266.46 g/mol, XLogP of 4.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-2,2,4-trimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde is sourced from PubChem (CID 11108313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).