C26H20N4O2S2 — CID 1110864
1-benzyl-3-[N-benzyl-C-(furan-2-yl)carbonimidoyl]-6-(furan-2-yl)-1,3,5-triazine-2,4-dithione (PubChem CID 1110864) has the molecular formula C26H20N4O2S2 and a molecular weight of 484.61 g/mol. Its IUPAC name is 1-benzyl-3-[N-benzyl-C-(furan-2-yl)carbonimidoyl]-6-(furan-2-yl)-1,3,5-triazine-2,4-dithione.
| Compound Name | 1-benzyl-3-[N-benzyl-C-(furan-2-yl)carbonimidoyl]-6-(furan-2-yl)-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 1110864 |
| Molecular Formula | C26H20N4O2S2 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 1-benzyl-3-[N-benzyl-C-(furan-2-yl)carbonimidoyl]-6-(furan-2-yl)-1,3,5-triazine-2,4-dithione |
| SMILES | S=c1nc(-c2ccco2)n(Cc2ccccc2)c(=S)n1/C(=N/Cc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C26H20N4O2S2/c33-25-28-24(22-14-8-16-32-22)29(18-20-11-5-2-6-12-20)26(34)30(25)23(21-13-7-15-31-21)27-17-19-9-3-1-4-10-19/h1-16H,17-18H2/b27-23+ |
| InChIKey | OWGBJISPDZNHMF-SLEBQGDGSA-N |
| XLogP | 6.54 |
| TPSA | 61.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|