C15H23IN4O — CID 111086466
2-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide (PubChem CID 111086466) has the molecular formula C15H23IN4O and a molecular weight of 402.28 g/mol. Its IUPAC name is 2-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide.
| Compound Name | 2-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111086466 |
| Molecular Formula | C15H23IN4O |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide |
| SMILES | C=C(C)CN/C(N)=N/Cc1ccc(OCC2CC2)nc1.I |
| InChI | InChI=1S/C15H22N4O.HI/c1-11(2)7-18-15(16)19-9-13-5-6-14(17-8-13)20-10-12-3-4-12;/h5-6,8,12H,1,3-4,7,9-10H2,2H3,(H3,16,18,19);1H |
| InChIKey | CTDPDSJYOKEERE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|