C25H37IN4O2 — CID 111087122
2-[[4-(azepan-1-ylmethyl)phenyl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111087122) has the molecular formula C25H37IN4O2 and a molecular weight of 552.50 g/mol. Its IUPAC name is 2-[[4-(azepan-1-ylmethyl)phenyl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[4-(azepan-1-ylmethyl)phenyl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111087122 |
| Molecular Formula | C25H37IN4O2 |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 2-[[4-(azepan-1-ylmethyl)phenyl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/Cc2ccc(CN3CCCCCC3)cc2)cc1OC.I |
| InChI | InChI=1S/C25H36N4O2.HI/c1-30-23-12-11-20(17-24(23)31-2)13-14-27-25(26)28-18-21-7-9-22(10-8-21)19-29-15-5-3-4-6-16-29;/h7-12,17H,3-6,13-16,18-19H2,1-2H3,(H3,26,27,28);1H |
| InChIKey | NNLUZUNQUCRCLE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|