C13H19BO6 — CID 11108791
dipropan-2-yl (4S,5S)-2-propa-1,2-dienyl-1,3,2-dioxaborolane-4,5-dicarboxylate (PubChem CID 11108791) has the molecular formula C13H19BO6 and a molecular weight of 282.10 g/mol. Its IUPAC name is dipropan-2-yl (4S,5S)-2-propa-1,2-dienyl-1,3,2-dioxaborolane-4,5-dicarboxylate.
| Compound Name | dipropan-2-yl (4S,5S)-2-propa-1,2-dienyl-1,3,2-dioxaborolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11108791 |
| Molecular Formula | C13H19BO6 |
| Molecular Weight | 282.10 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | dipropan-2-yl (4S,5S)-2-propa-1,2-dienyl-1,3,2-dioxaborolane-4,5-dicarboxylate |
| SMILES | C=C=CB1O[C@H](C(=O)OC(C)C)[C@@H](C(=O)OC(C)C)O1 |
| InChI | InChI=1S/C13H19BO6/c1-6-7-14-19-10(12(15)17-8(2)3)11(20-14)13(16)18-9(4)5/h7-11H,1H2,2-5H3/t10-,11-/m0/s1 |
| InChIKey | BCGBKOZHWYIMOK-QWRGUYRKSA-N |
| XLogP | 1.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.10 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|