C15H24O5 — CID 11108853
(4R,4aS,7R,7aR)-4-[(E)-3,3-dimethylbut-1-enyl]-7-methoxy-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one (PubChem CID 11108853) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (4R,4aS,7R,7aR)-4-[(E)-3,3-dimethylbut-1-enyl]-7-methoxy-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one.
| Compound Name | (4R,4aS,7R,7aR)-4-[(E)-3,3-dimethylbut-1-enyl]-7-methoxy-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
|---|---|
| PubChem CID | 11108853 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (4R,4aS,7R,7aR)-4-[(E)-3,3-dimethylbut-1-enyl]-7-methoxy-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
| SMILES | CO[C@H]1C(=O)O[C@@H]2[C@H]1OC(C)(C)O[C@@H]2/C=C/C(C)(C)C |
| InChI | InChI=1S/C15H24O5/c1-14(2,3)8-7-9-10-11(20-15(4,5)19-9)12(17-6)13(16)18-10/h7-12H,1-6H3/b8-7+/t9-,10+,11-,12-/m1/s1 |
| InChIKey | SJJOHEBNRPGWHQ-IDLRSZLASA-N |
| XLogP | 2.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|