About ethyl 3-[(1S,2R,3R)-3-methoxy-2-methyl-2-nitro-5-oxocyclohexyl]propanoate
ethyl 3-[(1S,2R,3R)-3-methoxy-2-methyl-2-nitro-5-oxocyclohexyl]propanoate (PubChem CID 11108945) has the molecular formula C13H21NO6
and a molecular weight of 287.31 g/mol. Its IUPAC name is ethyl 3-[(1S,2R,3R)-3-methoxy-2-methyl-2-nitro-5-oxocyclohexyl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[(1S,2R,3R)-3-methoxy-2-methyl-2-nitro-5-oxocyclohexyl]propanoate |
| PubChem CID | 11108945 |
| Molecular Formula | C13H21NO6 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | ethyl 3-[(1S,2R,3R)-3-methoxy-2-methyl-2-nitro-5-oxocyclohexyl]propanoate |
| SMILES | CCOC(=O)CC[C@H]1CC(=O)C[C@@H](OC)[C@]1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C13H21NO6/c1-4-20-12(16)6-5-9-7-10(15)8-11(19-3)13(9,2)14(17)18/h9,11H,4-8H2,1-3H3/t9-,11+,13+/m0/s1 |
| InChIKey | IARBXFXYKLWQIP-UFGOTCBOSA-N |
| XLogP | 1.36 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[(1S,2R,3R)-3-methoxy-2-methyl-2-nitro-5-oxocyclohexyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(1S,2R,3R)-3-methoxy-2-methyl-2-nitro-5-oxocyclohexyl]propanoate?
The IUPAC name of ethyl 3-[(1S,2R,3R)-3-methoxy-2-methyl-2-nitro-5-oxocyclohexyl]propanoate (CID 11108945) is ethyl 3-[(1S,2R,3R)-3-methoxy-2-methyl-2-nitro-5-oxocyclohexyl]propanoate.
What is the SMILES notation for ethyl 3-[(1S,2R,3R)-3-methoxy-2-methyl-2-nitro-5-oxocyclohexyl]propanoate?
The canonical SMILES for ethyl 3-[(1S,2R,3R)-3-methoxy-2-methyl-2-nitro-5-oxocyclohexyl]propanoate is CCOC(=O)CC[C@H]1CC(=O)C[C@@H](OC)[C@]1(C)[N+](=O)[O-].
What is the InChIKey of ethyl 3-[(1S,2R,3R)-3-methoxy-2-methyl-2-nitro-5-oxocyclohexyl]propanoate?
The InChIKey is IARBXFXYKLWQIP-UFGOTCBOSA-N. The full InChI is InChI=1S/C13H21NO6/c1-4-20-12(16)6-5-9-7-10(15)8-11(19-3)13(9,2)14(17)18/h9,11H,4-8H2,1-3H3/t9-,11+,13+/m0/s1.
What are the key properties of ethyl 3-[(1S,2R,3R)-3-methoxy-2-methyl-2-nitro-5-oxocyclohexyl]propanoate?
ethyl 3-[(1S,2R,3R)-3-methoxy-2-methyl-2-nitro-5-oxocyclohexyl]propanoate has a molecular weight of 287.31 g/mol, XLogP of 1.36, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(1S,2R,3R)-3-methoxy-2-methyl-2-nitro-5-oxocyclohexyl]propanoate is sourced from PubChem (CID 11108945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).