C17H24O4 — CID 11109096
tert-butyl (E)-7-(1-methyl-4-oxocyclopent-2-en-1-yl)-3-oxohept-4-enoate (PubChem CID 11109096) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl (E)-7-(1-methyl-4-oxocyclopent-2-en-1-yl)-3-oxohept-4-enoate.
| Compound Name | tert-butyl (E)-7-(1-methyl-4-oxocyclopent-2-en-1-yl)-3-oxohept-4-enoate |
|---|---|
| PubChem CID | 11109096 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | tert-butyl (E)-7-(1-methyl-4-oxocyclopent-2-en-1-yl)-3-oxohept-4-enoate |
| SMILES | CC1(CC/C=C/C(=O)CC(=O)OC(C)(C)C)C=CC(=O)C1 |
| InChI | InChI=1S/C17H24O4/c1-16(2,3)21-15(20)11-13(18)7-5-6-9-17(4)10-8-14(19)12-17/h5,7-8,10H,6,9,11-12H2,1-4H3/b7-5+ |
| InChIKey | LFWVSEUFMNYYRS-FNORWQNLSA-N |
| XLogP | 3.16 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|