C21H27FIN3O2 — CID 111091585
2-[(3,4-dimethoxyphenyl)methyl]-1-[[1-(4-fluorophenyl)cyclobutyl]methyl]guanidine;hydroiodide (PubChem CID 111091585) has the molecular formula C21H27FIN3O2 and a molecular weight of 499.37 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[[1-(4-fluorophenyl)cyclobutyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[[1-(4-fluorophenyl)cyclobutyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111091585 |
| Molecular Formula | C21H27FIN3O2 |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[[1-(4-fluorophenyl)cyclobutyl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)NCC2(c3ccc(F)cc3)CCC2)cc1OC.I |
| InChI | InChI=1S/C21H26FN3O2.HI/c1-26-18-9-4-15(12-19(18)27-2)13-24-20(23)25-14-21(10-3-11-21)16-5-7-17(22)8-6-16;/h4-9,12H,3,10-11,13-14H2,1-2H3,(H3,23,24,25);1H |
| InChIKey | VZXQNZWODHXTFV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|