C15H24O2SSi — CID 11109246
methyl (2S,3S)-2-methyl-3-(2-trimethylsilylphenyl)sulfanylbutanoate (PubChem CID 11109246) has the molecular formula C15H24O2SSi and a molecular weight of 296.51 g/mol. Its IUPAC name is methyl (2S,3S)-2-methyl-3-(2-trimethylsilylphenyl)sulfanylbutanoate.
| Compound Name | methyl (2S,3S)-2-methyl-3-(2-trimethylsilylphenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 11109246 |
| Molecular Formula | C15H24O2SSi |
| Molecular Weight | 296.51 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | methyl (2S,3S)-2-methyl-3-(2-trimethylsilylphenyl)sulfanylbutanoate |
| SMILES | COC(=O)[C@H](C)[C@H](C)Sc1ccccc1[Si](C)(C)C |
| InChI | InChI=1S/C15H24O2SSi/c1-11(15(16)17-3)12(2)18-13-9-7-8-10-14(13)19(4,5)6/h7-12H,1-6H3/t11-,12+/m1/s1 |
| InChIKey | JRJPBFUFEZXGDF-NEPJUHHUSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|