C20H27NO — CID 11109270
(1R,3R)-1-(benzylamino)-5-methyl-1-phenylhexan-3-ol (PubChem CID 11109270) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is (1R,3R)-1-(benzylamino)-5-methyl-1-phenylhexan-3-ol.
| Compound Name | (1R,3R)-1-(benzylamino)-5-methyl-1-phenylhexan-3-ol |
|---|---|
| PubChem CID | 11109270 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (1R,3R)-1-(benzylamino)-5-methyl-1-phenylhexan-3-ol |
| SMILES | CC(C)C[C@@H](O)C[C@@H](NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H27NO/c1-16(2)13-19(22)14-20(18-11-7-4-8-12-18)21-15-17-9-5-3-6-10-17/h3-12,16,19-22H,13-15H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | KBJNXBVOBNIGSF-WOJBJXKFSA-N |
| XLogP | 4.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |