About 2-[(E)-6-bromo-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexene
2-[(E)-6-bromo-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexene (PubChem CID 11109335) has the molecular formula C16H27Br
and a molecular weight of 299.30 g/mol. Its IUPAC name is 2-[(E)-6-bromo-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexene.
Molecular Properties
| Compound Name | 2-[(E)-6-bromo-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexene |
| PubChem CID | 11109335 |
| Molecular Formula | C16H27Br |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-[(E)-6-bromo-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexene |
| SMILES | CC1=C(CC/C(C)=C/CCBr)C(C)(C)CCC1 |
| InChI | InChI=1S/C16H27Br/c1-13(7-6-12-17)9-10-15-14(2)8-5-11-16(15,3)4/h7H,5-6,8-12H2,1-4H3/b13-7+ |
| InChIKey | JIAOWXWJOBVFLL-NTUHNPAUSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-6-bromo-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-6-bromo-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexene?
The IUPAC name of 2-[(E)-6-bromo-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexene (CID 11109335) is 2-[(E)-6-bromo-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexene.
What is the SMILES notation for 2-[(E)-6-bromo-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexene?
The canonical SMILES for 2-[(E)-6-bromo-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexene is CC1=C(CC/C(C)=C/CCBr)C(C)(C)CCC1.
What is the InChIKey of 2-[(E)-6-bromo-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexene?
The InChIKey is JIAOWXWJOBVFLL-NTUHNPAUSA-N. The full InChI is InChI=1S/C16H27Br/c1-13(7-6-12-17)9-10-15-14(2)8-5-11-16(15,3)4/h7H,5-6,8-12H2,1-4H3/b13-7+.
What are the key properties of 2-[(E)-6-bromo-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexene?
2-[(E)-6-bromo-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexene has a molecular weight of 299.30 g/mol, XLogP of 6.02, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-6-bromo-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexene is sourced from PubChem (CID 11109335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).