C10H19IN4O — CID 111093384
2-[[amino-(2-methylpropylamino)methylidene]amino]-N-prop-2-ynylacetamide;hydroiodide (PubChem CID 111093384) has the molecular formula C10H19IN4O and a molecular weight of 338.19 g/mol. Its IUPAC name is 2-[[amino-(2-methylpropylamino)methylidene]amino]-N-prop-2-ynylacetamide;hydroiodide.
| Compound Name | 2-[[amino-(2-methylpropylamino)methylidene]amino]-N-prop-2-ynylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111093384 |
| Molecular Formula | C10H19IN4O |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-[[amino-(2-methylpropylamino)methylidene]amino]-N-prop-2-ynylacetamide;hydroiodide |
| SMILES | C#CCNC(=O)C/N=C(\N)NCC(C)C.I |
| InChI | InChI=1S/C10H18N4O.HI/c1-4-5-12-9(15)7-14-10(11)13-6-8(2)3;/h1,8H,5-7H2,2-3H3,(H,12,15)(H3,11,13,14);1H |
| InChIKey | SOYVWQDMNSXCOC-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|