C15H26N4O3S — CID 111093527
2-[3-(ethylsulfonylamino)propyl]-1-(4-propan-2-yloxyphenyl)guanidine (PubChem CID 111093527) has the molecular formula C15H26N4O3S and a molecular weight of 342.47 g/mol. Its IUPAC name is 2-[3-(ethylsulfonylamino)propyl]-1-(4-propan-2-yloxyphenyl)guanidine.
| Compound Name | 2-[3-(ethylsulfonylamino)propyl]-1-(4-propan-2-yloxyphenyl)guanidine |
|---|---|
| PubChem CID | 111093527 |
| Molecular Formula | C15H26N4O3S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-[3-(ethylsulfonylamino)propyl]-1-(4-propan-2-yloxyphenyl)guanidine |
| SMILES | CCS(=O)(=O)NCCC/N=C(\N)Nc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C15H26N4O3S/c1-4-23(20,21)18-11-5-10-17-15(16)19-13-6-8-14(9-7-13)22-12(2)3/h6-9,12,18H,4-5,10-11H2,1-3H3,(H3,16,17,19) |
| InChIKey | YIPGRSYLQRBSMU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|