C20H24BrIN4O — CID 111094248
3-[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]-N-(5-bromo-2-methylphenyl)propanamide;hydroiodide (PubChem CID 111094248) has the molecular formula C20H24BrIN4O and a molecular weight of 543.25 g/mol. Its IUPAC name is 3-[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]-N-(5-bromo-2-methylphenyl)propanamide;hydroiodide.
| Compound Name | 3-[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]-N-(5-bromo-2-methylphenyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111094248 |
| Molecular Formula | C20H24BrIN4O |
| Molecular Weight | 543.25 g/mol |
| Exact Mass | 542.02 |
| IUPAC Name | 3-[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]-N-(5-bromo-2-methylphenyl)propanamide;hydroiodide |
| SMILES | Cc1ccc(Br)cc1NC(=O)CC/N=C(\N)Nc1ccc2c(c1)CCC2.I |
| InChI | InChI=1S/C20H23BrN4O.HI/c1-13-5-7-16(21)12-18(13)25-19(26)9-10-23-20(22)24-17-8-6-14-3-2-4-15(14)11-17;/h5-8,11-12H,2-4,9-10H2,1H3,(H,25,26)(H3,22,23,24);1H |
| InChIKey | NUGPGMFGNRVWQO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.25 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|