C18H21N5 — CID 11109590
4-phenyl-2,6-di(propan-2-yl)-1-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyridin-1-ium (PubChem CID 11109590) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 4-phenyl-2,6-di(propan-2-yl)-1-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyridin-1-ium.
| Compound Name | 4-phenyl-2,6-di(propan-2-yl)-1-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 11109590 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-phenyl-2,6-di(propan-2-yl)-1-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyridin-1-ium |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)[n+]1-c1nnn[n-]1 |
| InChI | InChI=1S/C18H21N5/c1-12(2)16-10-15(14-8-6-5-7-9-14)11-17(13(3)4)23(16)18-19-21-22-20-18/h5-13H,1-4H3 |
| InChIKey | UZNRFTWCFQFYEL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 56.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|