C16H20O6 — CID 11109605
(3E,8R,11E,16R)-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,5,10,13-tetrone (PubChem CID 11109605) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is (3E,8R,11E,16R)-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,5,10,13-tetrone.
| Compound Name | (3E,8R,11E,16R)-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,5,10,13-tetrone |
|---|---|
| PubChem CID | 11109605 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (3E,8R,11E,16R)-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,5,10,13-tetrone |
| SMILES | C[C@@H]1CCC(=O)/C=C/C(=O)O[C@H](C)CCC(=O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C16H20O6/c1-11-3-5-13(17)8-10-16(20)22-12(2)4-6-14(18)7-9-15(19)21-11/h7-12H,3-6H2,1-2H3/b9-7+,10-8+/t11-,12-/m1/s1 |
| InChIKey | PJHRIHGUXQTQLU-NVXYJICISA-N |
| XLogP | 1.67 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |