C17H30O3Si — CID 11109695
(1S,3aS,5E,6aS)-5-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-1-(hydroxymethyl)-1,3,3a,4,6,6a-hexahydropentalen-2-one (PubChem CID 11109695) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is (1S,3aS,5E,6aS)-5-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-1-(hydroxymethyl)-1,3,3a,4,6,6a-hexahydropentalen-2-one.
| Compound Name | (1S,3aS,5E,6aS)-5-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-1-(hydroxymethyl)-1,3,3a,4,6,6a-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 11109695 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (1S,3aS,5E,6aS)-5-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-1-(hydroxymethyl)-1,3,3a,4,6,6a-hexahydropentalen-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C1\C[C@H]2CC(=O)[C@H](CO)[C@H]2C1 |
| InChI | InChI=1S/C17H30O3Si/c1-17(2,3)21(4,5)20-7-6-12-8-13-10-16(19)15(11-18)14(13)9-12/h6,13-15,18H,7-11H2,1-5H3/b12-6+/t13-,14-,15+/m0/s1 |
| InChIKey | NIOGLIJKJBIEBS-GOHRIHQBSA-N |
| XLogP | 3.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|