C17H32O3Si — CID 11109765
ethyl (2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhepta-2,4-dienoate (PubChem CID 11109765) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is ethyl (2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhepta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 11109765 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | ethyl (2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhepta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/C(C)(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O3Si/c1-9-19-15(18)12-10-11-13-17(5,6)14-20-21(7,8)16(2,3)4/h10-13H,9,14H2,1-8H3/b12-10+,13-11+ |
| InChIKey | UTVWXHASIWKQME-DCIPZJNNSA-N |
| XLogP | 4.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|