C16H25F3IN3O — CID 111097702
1-butyl-2-[[4-propan-2-yloxy-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111097702) has the molecular formula C16H25F3IN3O and a molecular weight of 459.29 g/mol. Its IUPAC name is 1-butyl-2-[[4-propan-2-yloxy-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-2-[[4-propan-2-yloxy-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111097702 |
| Molecular Formula | C16H25F3IN3O |
| Molecular Weight | 459.29 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 1-butyl-2-[[4-propan-2-yloxy-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCCCN/C(N)=N/Cc1ccc(OC(C)C)cc1C(F)(F)F.I |
| InChI | InChI=1S/C16H24F3N3O.HI/c1-4-5-8-21-15(20)22-10-12-6-7-13(23-11(2)3)9-14(12)16(17,18)19;/h6-7,9,11H,4-5,8,10H2,1-3H3,(H3,20,21,22);1H |
| InChIKey | WAORMRWZSAAXJD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|