C19H25NO3 — CID 11109849
(4R,5S)-4-methyl-5-phenyl-3-[(2S)-2-prop-2-enylhexanoyl]-1,3-oxazolidin-2-one (PubChem CID 11109849) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (4R,5S)-4-methyl-5-phenyl-3-[(2S)-2-prop-2-enylhexanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-4-methyl-5-phenyl-3-[(2S)-2-prop-2-enylhexanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11109849 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (4R,5S)-4-methyl-5-phenyl-3-[(2S)-2-prop-2-enylhexanoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H](CCCC)C(=O)N1C(=O)O[C@@H](c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C19H25NO3/c1-4-6-11-16(10-5-2)18(21)20-14(3)17(23-19(20)22)15-12-8-7-9-13-15/h5,7-9,12-14,16-17H,2,4,6,10-11H2,1,3H3/t14-,16-,17-/m1/s1 |
| InChIKey | KOAKLEBMAKZCHX-DJIMGWMZSA-N |
| XLogP | 4.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|