C23H38IN5O3 — CID 111098552
1-(4-methoxyphenyl)-2-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]guanidine;hydroiodide (PubChem CID 111098552) has the molecular formula C23H38IN5O3 and a molecular weight of 559.49 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]guanidine;hydroiodide.
| Compound Name | 1-(4-methoxyphenyl)-2-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111098552 |
| Molecular Formula | C23H38IN5O3 |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCCCCC(=O)N2CCN(C(=O)CC(C)C)CC2)cc1.I |
| InChI | InChI=1S/C23H37N5O3.HI/c1-18(2)17-22(30)28-15-13-27(14-16-28)21(29)7-5-4-6-12-25-23(24)26-19-8-10-20(31-3)11-9-19;/h8-11,18H,4-7,12-17H2,1-3H3,(H3,24,25,26);1H |
| InChIKey | BPXKTTCCQORDEZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|