C23H24IN3O3 — CID 111099727
benzyl 3-[[[amino-(3-methoxyanilino)methylidene]amino]methyl]benzoate;hydroiodide (PubChem CID 111099727) has the molecular formula C23H24IN3O3 and a molecular weight of 517.37 g/mol. Its IUPAC name is benzyl 3-[[[amino-(3-methoxyanilino)methylidene]amino]methyl]benzoate;hydroiodide.
| Compound Name | benzyl 3-[[[amino-(3-methoxyanilino)methylidene]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111099727 |
| Molecular Formula | C23H24IN3O3 |
| Molecular Weight | 517.37 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | benzyl 3-[[[amino-(3-methoxyanilino)methylidene]amino]methyl]benzoate;hydroiodide |
| SMILES | COc1cccc(N/C(N)=N/Cc2cccc(C(=O)OCc3ccccc3)c2)c1.I |
| InChI | InChI=1S/C23H23N3O3.HI/c1-28-21-12-6-11-20(14-21)26-23(24)25-15-18-9-5-10-19(13-18)22(27)29-16-17-7-3-2-4-8-17;/h2-14H,15-16H2,1H3,(H3,24,25,26);1H |
| InChIKey | AEMCTFONJNHKEU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|